C19H26N4O5 — CID 55326771
2-(4-butyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(2-methoxyethylcarbamoyl)acetamide (PubChem CID 55326771) has the molecular formula C19H26N4O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-(4-butyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(2-methoxyethylcarbamoyl)acetamide.
| Compound Name | 2-(4-butyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(2-methoxyethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 55326771 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 2-(4-butyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(2-methoxyethylcarbamoyl)acetamide |
| SMILES | CCCCC1(c2ccccc2)NC(=O)N(CC(=O)NC(=O)NCCOC)C1=O |
| InChI | InChI=1S/C19H26N4O5/c1-3-4-10-19(14-8-6-5-7-9-14)16(25)23(18(27)22-19)13-15(24)21-17(26)20-11-12-28-2/h5-9H,3-4,10-13H2,1-2H3,(H,22,27)(H2,20,21,24,26) |
| InChIKey | QXFYLIIKEBRKMP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|