C16H19N5O7 — CID 43075658
N-(2-methoxyethylcarbamoyl)-2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 43075658) has the molecular formula C16H19N5O7 and a molecular weight of 393.36 g/mol. Its IUPAC name is N-(2-methoxyethylcarbamoyl)-2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-methoxyethylcarbamoyl)-2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 43075658 |
| Molecular Formula | C16H19N5O7 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-(2-methoxyethylcarbamoyl)-2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | COCCNC(=O)NC(=O)CN1C(=O)NC(C)(c2cccc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C16H19N5O7/c1-16(10-4-3-5-11(8-10)21(26)27)13(23)20(15(25)19-16)9-12(22)18-14(24)17-6-7-28-2/h3-5,8H,6-7,9H2,1-2H3,(H,19,25)(H2,17,18,22,24) |
| InChIKey | GOTNWMPZHYATNR-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 159.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|