C21H22N4O7 — CID 55684983
N-[(3,4-dimethoxyphenyl)methyl]-2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 55684983) has the molecular formula C21H22N4O7 and a molecular weight of 442.43 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55684983 |
| Molecular Formula | C21H22N4O7 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | COc1ccc(CNC(=O)CN2C(=O)NC(C)(c3cccc([N+](=O)[O-])c3)C2=O)cc1OC |
| InChI | InChI=1S/C21H22N4O7/c1-21(14-5-4-6-15(10-14)25(29)30)19(27)24(20(28)23-21)12-18(26)22-11-13-7-8-16(31-2)17(9-13)32-3/h4-10H,11-12H2,1-3H3,(H,22,26)(H,23,28) |
| InChIKey | KDNJMHACDWRONG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|