C21H20N4O7 — CID 40856448
methyl 4-[[[2-[(4R)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]methyl]benzoate (PubChem CID 40856448) has the molecular formula C21H20N4O7 and a molecular weight of 440.41 g/mol. Its IUPAC name is methyl 4-[[[2-[(4R)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-[(4R)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 40856448 |
| Molecular Formula | C21H20N4O7 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | methyl 4-[[[2-[(4R)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)CN2C(=O)N[C@](C)(c3ccc([N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H20N4O7/c1-21(15-7-9-16(10-8-15)25(30)31)19(28)24(20(29)23-21)12-17(26)22-11-13-3-5-14(6-4-13)18(27)32-2/h3-10H,11-12H2,1-2H3,(H,22,26)(H,23,29)/t21-/m1/s1 |
| InChIKey | FRVHYNVVNYRDBN-OAQYLSRUSA-N |
| XLogP | 1.46 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|