C21H20BrN3O5 — CID 47093761
methyl 4-[[[2-[4-(2-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]methyl]benzoate (PubChem CID 47093761) has the molecular formula C21H20BrN3O5 and a molecular weight of 474.31 g/mol. Its IUPAC name is methyl 4-[[[2-[4-(2-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-[4-(2-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 47093761 |
| Molecular Formula | C21H20BrN3O5 |
| Molecular Weight | 474.31 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | methyl 4-[[[2-[4-(2-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)CN2C(=O)NC(C)(c3ccccc3Br)C2=O)cc1 |
| InChI | InChI=1S/C21H20BrN3O5/c1-21(15-5-3-4-6-16(15)22)19(28)25(20(29)24-21)12-17(26)23-11-13-7-9-14(10-8-13)18(27)30-2/h3-10H,11-12H2,1-2H3,(H,23,26)(H,24,29) |
| InChIKey | AEVHJHHYZYNHGC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|