C20H20BrN3O5 — CID 2702725
2-[(4R)-4-(2-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3,5-dimethoxyphenyl)acetamide (PubChem CID 2702725) has the molecular formula C20H20BrN3O5 and a molecular weight of 462.30 g/mol. Its IUPAC name is 2-[(4R)-4-(2-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-[(4R)-4-(2-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2702725 |
| Molecular Formula | C20H20BrN3O5 |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 2-[(4R)-4-(2-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3,5-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)CN2C(=O)N[C@](C)(c3ccccc3Br)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C20H20BrN3O5/c1-20(15-6-4-5-7-16(15)21)18(26)24(19(27)23-20)11-17(25)22-12-8-13(28-2)10-14(9-12)29-3/h4-10H,11H2,1-3H3,(H,22,25)(H,23,27)/t20-/m1/s1 |
| InChIKey | HGCQUOPEWJRSLJ-HXUWFJFHSA-N |
| XLogP | 2.87 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|