C18H15BrN4O5 — CID 24654212
2-[4-(2-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-nitrophenyl)acetamide (PubChem CID 24654212) has the molecular formula C18H15BrN4O5 and a molecular weight of 447.25 g/mol. Its IUPAC name is 2-[4-(2-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[4-(2-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 24654212 |
| Molecular Formula | C18H15BrN4O5 |
| Molecular Weight | 447.25 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 2-[4-(2-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-nitrophenyl)acetamide |
| SMILES | CC1(c2ccccc2Br)NC(=O)N(CC(=O)Nc2cccc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C18H15BrN4O5/c1-18(13-7-2-3-8-14(13)19)16(25)22(17(26)21-18)10-15(24)20-11-5-4-6-12(9-11)23(27)28/h2-9H,10H2,1H3,(H,20,24)(H,21,26) |
| InChIKey | OOUCSOJSSPVGIG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|