C20H16F3N5O6 — CID 43075675
2-[[2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 43075675) has the molecular formula C20H16F3N5O6 and a molecular weight of 479.37 g/mol. Its IUPAC name is 2-[[2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 43075675 |
| Molecular Formula | C20H16F3N5O6 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 2-[[2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CC1(c2cccc([N+](=O)[O-])c2)NC(=O)N(CC(=O)NCC(=O)Nc2ccc(F)c(F)c2F)C1=O |
| InChI | InChI=1S/C20H16F3N5O6/c1-20(10-3-2-4-11(7-10)28(33)34)18(31)27(19(32)26-20)9-15(30)24-8-14(29)25-13-6-5-12(21)16(22)17(13)23/h2-7H,8-9H2,1H3,(H,24,30)(H,25,29)(H,26,32) |
| InChIKey | ZUDHKPORQUVCAA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 150.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|