C20H17N5O5S — CID 43075672
N-[2-(cyanomethylsulfanyl)phenyl]-2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 43075672) has the molecular formula C20H17N5O5S and a molecular weight of 439.45 g/mol. Its IUPAC name is N-[2-(cyanomethylsulfanyl)phenyl]-2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 43075672 |
| Molecular Formula | C20H17N5O5S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC1(c2cccc([N+](=O)[O-])c2)NC(=O)N(CC(=O)Nc2ccccc2SCC#N)C1=O |
| InChI | InChI=1S/C20H17N5O5S/c1-20(13-5-4-6-14(11-13)25(29)30)18(27)24(19(28)23-20)12-17(26)22-15-7-2-3-8-16(15)31-10-9-21/h2-8,11H,10,12H2,1H3,(H,22,26)(H,23,28) |
| InChIKey | UBWIYJXNGCKFDF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 145.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|