C18H14ClFN4O5 — CID 2702285
2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-fluoro-5-nitrophenyl)acetamide (PubChem CID 2702285) has the molecular formula C18H14ClFN4O5 and a molecular weight of 420.78 g/mol. Its IUPAC name is 2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-fluoro-5-nitrophenyl)acetamide.
| Compound Name | 2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-fluoro-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2702285 |
| Molecular Formula | C18H14ClFN4O5 |
| Molecular Weight | 420.78 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-fluoro-5-nitrophenyl)acetamide |
| SMILES | C[C@@]1(c2ccccc2Cl)NC(=O)N(CC(=O)Nc2cc([N+](=O)[O-])ccc2F)C1=O |
| InChI | InChI=1S/C18H14ClFN4O5/c1-18(11-4-2-3-5-12(11)19)16(26)23(17(27)22-18)9-15(25)21-14-8-10(24(28)29)6-7-13(14)20/h2-8H,9H2,1H3,(H,21,25)(H,22,27)/t18-/m0/s1 |
| InChIKey | RMENPENOCDSHOW-SFHVURJKSA-N |
| XLogP | 2.79 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.78 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|