C22H25N3O5 — CID 18774902
2-[4-(3,4-dimethoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-phenylethyl)acetamide (PubChem CID 18774902) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-[4-(3,4-dimethoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[4-(3,4-dimethoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 18774902 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-[4-(3,4-dimethoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-phenylethyl)acetamide |
| SMILES | COc1ccc(C2(C)NC(=O)N(CC(=O)NCCc3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C22H25N3O5/c1-22(16-9-10-17(29-2)18(13-16)30-3)20(27)25(21(28)24-22)14-19(26)23-12-11-15-7-5-4-6-8-15/h4-10,13H,11-12,14H2,1-3H3,(H,23,26)(H,24,28) |
| InChIKey | DWEDTRKRBUPTDF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|