C26H25N3O5 — CID 2612679
2-[(4R)-4-(3,4-dimethoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-phenylphenyl)acetamide (PubChem CID 2612679) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is 2-[(4R)-4-(3,4-dimethoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-phenylphenyl)acetamide.
| Compound Name | 2-[(4R)-4-(3,4-dimethoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 2612679 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 2-[(4R)-4-(3,4-dimethoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-phenylphenyl)acetamide |
| SMILES | COc1ccc([C@@]2(C)NC(=O)N(CC(=O)Nc3ccc(-c4ccccc4)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C26H25N3O5/c1-26(19-11-14-21(33-2)22(15-19)34-3)24(31)29(25(32)28-26)16-23(30)27-20-12-9-18(10-13-20)17-7-5-4-6-8-17/h4-15H,16H2,1-3H3,(H,27,30)(H,28,32)/t26-/m1/s1 |
| InChIKey | BJPIRKICZLMYOR-AREMUKBSSA-N |
| XLogP | 3.78 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|