C20H23ClN4O4 — CID 119419114
N-(3-amino-4-methoxyphenyl)-2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide;hydrochloride (PubChem CID 119419114) has the molecular formula C20H23ClN4O4 and a molecular weight of 418.88 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide;hydrochloride.
| Compound Name | N-(3-amino-4-methoxyphenyl)-2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119419114 |
| Molecular Formula | C20H23ClN4O4 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)CN2C(=O)NC(C)(c3ccc(C)cc3)C2=O)cc1N.Cl |
| InChI | InChI=1S/C20H22N4O4.ClH/c1-12-4-6-13(7-5-12)20(2)18(26)24(19(27)23-20)11-17(25)22-14-8-9-16(28-3)15(21)10-14;/h4-10H,11,21H2,1-3H3,(H,22,25)(H,23,27);1H |
| InChIKey | RTQZPSANWMIXOO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|