C17H22N4O4 — CID 119419131
N-(3-amino-4-methoxyphenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 119419131) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-(3-amino-4-methoxyphenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 119419131 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)NC3(CCCCC3)C2=O)cc1N |
| InChI | InChI=1S/C17H22N4O4/c1-25-13-6-5-11(9-12(13)18)19-14(22)10-21-15(23)17(20-16(21)24)7-3-2-4-8-17/h5-6,9H,2-4,7-8,10,18H2,1H3,(H,19,22)(H,20,24) |
| InChIKey | KCCHEHXASZESSU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|