C27H26N4O5 — CID 51437759
N-(2-methoxyphenyl)-4-[[2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide (PubChem CID 51437759) has the molecular formula C27H26N4O5 and a molecular weight of 486.53 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-4-[[2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide.
| Compound Name | N-(2-methoxyphenyl)-4-[[2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 51437759 |
| Molecular Formula | C27H26N4O5 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | N-(2-methoxyphenyl)-4-[[2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC(=O)CN2C(=O)N[C@@](C)(c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H26N4O5/c1-17-8-12-19(13-9-17)27(2)25(34)31(26(35)30-27)16-23(32)28-20-14-10-18(11-15-20)24(33)29-21-6-4-5-7-22(21)36-3/h4-15H,16H2,1-3H3,(H,28,32)(H,29,33)(H,30,35)/t27-/m0/s1 |
| InChIKey | RKDZIACCWOLTJJ-MHZLTWQESA-N |
| XLogP | 3.66 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|