C22H23F2N3O4 — CID 41123926
2-[(4R)-4-butyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide (PubChem CID 41123926) has the molecular formula C22H23F2N3O4 and a molecular weight of 431.44 g/mol. Its IUPAC name is 2-[(4R)-4-butyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[(4R)-4-butyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 41123926 |
| Molecular Formula | C22H23F2N3O4 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-[(4R)-4-butyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide |
| SMILES | CCCC[C@]1(c2ccccc2)NC(=O)N(CC(=O)Nc2ccc(OC(F)F)cc2)C1=O |
| InChI | InChI=1S/C22H23F2N3O4/c1-2-3-13-22(15-7-5-4-6-8-15)19(29)27(21(30)26-22)14-18(28)25-16-9-11-17(12-10-16)31-20(23)24/h4-12,20H,2-3,13-14H2,1H3,(H,25,28)(H,26,30)/t22-/m1/s1 |
| InChIKey | LSRIWGHWJOMXTI-JOCHJYFZSA-N |
| XLogP | 3.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|