C21H23N3O3S — CID 24566026
2-(2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl)-N-(4-methylsulfanylphenyl)acetamide (PubChem CID 24566026) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-(2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl)-N-(4-methylsulfanylphenyl)acetamide.
| Compound Name | 2-(2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl)-N-(4-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 24566026 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-(2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl)-N-(4-methylsulfanylphenyl)acetamide |
| SMILES | CCCC1(c2ccccc2)NC(=O)N(CC(=O)Nc2ccc(SC)cc2)C1=O |
| InChI | InChI=1S/C21H23N3O3S/c1-3-13-21(15-7-5-4-6-8-15)19(26)24(20(27)23-21)14-18(25)22-16-9-11-17(28-2)12-10-16/h4-12H,3,13-14H2,1-2H3,(H,22,25)(H,23,27) |
| InChIKey | ASZRYOXGUVXIAQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|