C20H21N3O3S — CID 7179860
2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(3-methylsulfanylphenyl)acetamide (PubChem CID 7179860) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(3-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(3-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 7179860 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(3-methylsulfanylphenyl)acetamide |
| SMILES | CC[C@@]1(c2ccccc2)NC(=O)N(CC(=O)Nc2cccc(SC)c2)C1=O |
| InChI | InChI=1S/C20H21N3O3S/c1-3-20(14-8-5-4-6-9-14)18(25)23(19(26)22-20)13-17(24)21-15-10-7-11-16(12-15)27-2/h4-12H,3,13H2,1-2H3,(H,21,24)(H,22,26)/t20-/m0/s1 |
| InChIKey | FNWQTBYYNQXXEO-FQEVSTJZSA-N |
| XLogP | 3.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|