C16H19FN4O4 — CID 4814167
N-(ethylcarbamoyl)-2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 4814167) has the molecular formula C16H19FN4O4 and a molecular weight of 350.35 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(ethylcarbamoyl)-2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 4814167 |
| Molecular Formula | C16H19FN4O4 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-(ethylcarbamoyl)-2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCNC(=O)NC(=O)CN1C(=O)NC(CC)(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C16H19FN4O4/c1-3-16(10-5-7-11(17)8-6-10)13(23)21(15(25)20-16)9-12(22)19-14(24)18-4-2/h5-8H,3-4,9H2,1-2H3,(H,20,25)(H2,18,19,22,24) |
| InChIKey | WQRYKVXJSLJQON-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|