C19H17FIN3O3 — CID 4804766
2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(4-iodophenyl)acetamide (PubChem CID 4804766) has the molecular formula C19H17FIN3O3 and a molecular weight of 481.27 g/mol. Its IUPAC name is 2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 4804766 |
| Molecular Formula | C19H17FIN3O3 |
| Molecular Weight | 481.27 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | 2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(4-iodophenyl)acetamide |
| SMILES | CCC1(c2ccc(F)cc2)NC(=O)N(CC(=O)Nc2ccc(I)cc2)C1=O |
| InChI | InChI=1S/C19H17FIN3O3/c1-2-19(12-3-5-13(20)6-4-12)17(26)24(18(27)23-19)11-16(25)22-15-9-7-14(21)8-10-15/h3-10H,2,11H2,1H3,(H,22,25)(H,23,27) |
| InChIKey | RCRMZMNAWZFNCE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|