C22H25N3O5 — CID 7595517
N-(4-ethoxyphenyl)-2-[(4R)-4-ethyl-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 7595517) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[(4R)-4-ethyl-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[(4R)-4-ethyl-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 7595517 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[(4R)-4-ethyl-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCOc1ccc(NC(=O)CN2C(=O)N[C@](CC)(c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H25N3O5/c1-4-22(15-6-10-17(29-3)11-7-15)20(27)25(21(28)24-22)14-19(26)23-16-8-12-18(13-9-16)30-5-2/h6-13H,4-5,14H2,1-3H3,(H,23,26)(H,24,28)/t22-/m1/s1 |
| InChIKey | JWIZEEAVSGEASR-JOCHJYFZSA-N |
| XLogP | 2.89 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|