C20H19F2N3O4 — CID 7802383
N-(2,5-difluorophenyl)-2-[(4S)-4-ethyl-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 7802383) has the molecular formula C20H19F2N3O4 and a molecular weight of 403.39 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-[(4S)-4-ethyl-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2,5-difluorophenyl)-2-[(4S)-4-ethyl-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 7802383 |
| Molecular Formula | C20H19F2N3O4 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-[(4S)-4-ethyl-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC[C@@]1(c2ccc(OC)cc2)NC(=O)N(CC(=O)Nc2cc(F)ccc2F)C1=O |
| InChI | InChI=1S/C20H19F2N3O4/c1-3-20(12-4-7-14(29-2)8-5-12)18(27)25(19(28)24-20)11-17(26)23-16-10-13(21)6-9-15(16)22/h4-10H,3,11H2,1-2H3,(H,23,26)(H,24,28)/t20-/m0/s1 |
| InChIKey | RFQKMMCLLIJBRG-FQEVSTJZSA-N |
| XLogP | 2.77 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|