C17H21FN4O4 — CID 8571207
N-ethyl-2-[[2-[(4R)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]acetamide (PubChem CID 8571207) has the molecular formula C17H21FN4O4 and a molecular weight of 364.38 g/mol. Its IUPAC name is N-ethyl-2-[[2-[(4R)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]acetamide.
| Compound Name | N-ethyl-2-[[2-[(4R)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 8571207 |
| Molecular Formula | C17H21FN4O4 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-ethyl-2-[[2-[(4R)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]acetamide |
| SMILES | CCNC(=O)CNC(=O)CN1C(=O)N[C@](CC)(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C17H21FN4O4/c1-3-17(11-5-7-12(18)8-6-11)15(25)22(16(26)21-17)10-14(24)20-9-13(23)19-4-2/h5-8H,3-4,9-10H2,1-2H3,(H,19,23)(H,20,24)(H,21,26)/t17-/m1/s1 |
| InChIKey | QPRSUNQVVFSKPZ-QGZVFWFLSA-N |
| XLogP | 0.24 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|