C18H18FN3O4 — CID 4804760
2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 4804760) has the molecular formula C18H18FN3O4 and a molecular weight of 359.36 g/mol. Its IUPAC name is 2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4804760 |
| Molecular Formula | C18H18FN3O4 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCC1(c2ccc(F)cc2)NC(=O)N(CC(=O)NCc2ccco2)C1=O |
| InChI | InChI=1S/C18H18FN3O4/c1-2-18(12-5-7-13(19)8-6-12)16(24)22(17(25)21-18)11-15(23)20-10-14-4-3-9-26-14/h3-9H,2,10-11H2,1H3,(H,20,23)(H,21,25) |
| InChIKey | SHDRLJXZJAXOIB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|