C20H28FN3O3 — CID 7620481
2-[(4S)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(2R)-3-methylbutan-2-yl]acetamide (PubChem CID 7620481) has the molecular formula C20H28FN3O3 and a molecular weight of 377.46 g/mol. Its IUPAC name is 2-[(4S)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(2R)-3-methylbutan-2-yl]acetamide.
| Compound Name | 2-[(4S)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(2R)-3-methylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 7620481 |
| Molecular Formula | C20H28FN3O3 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-[(4S)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(2R)-3-methylbutan-2-yl]acetamide |
| SMILES | CCCC[C@@]1(c2ccc(F)cc2)NC(=O)N(CC(=O)N[C@H](C)C(C)C)C1=O |
| InChI | InChI=1S/C20H28FN3O3/c1-5-6-11-20(15-7-9-16(21)10-8-15)18(26)24(19(27)23-20)12-17(25)22-14(4)13(2)3/h7-10,13-14H,5-6,11-12H2,1-4H3,(H,22,25)(H,23,27)/t14-,20+/m1/s1 |
| InChIKey | HBCTVGXOLOOICU-VLIAUNLRSA-N |
| XLogP | 2.92 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|