C21H20F2N2O3 — CID 8675979
(5S)-5-butyl-5-(4-fluorophenyl)-3-[2-(3-fluorophenyl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 8675979) has the molecular formula C21H20F2N2O3 and a molecular weight of 386.40 g/mol. Its IUPAC name is (5S)-5-butyl-5-(4-fluorophenyl)-3-[2-(3-fluorophenyl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-butyl-5-(4-fluorophenyl)-3-[2-(3-fluorophenyl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 8675979 |
| Molecular Formula | C21H20F2N2O3 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (5S)-5-butyl-5-(4-fluorophenyl)-3-[2-(3-fluorophenyl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | CCCC[C@@]1(c2ccc(F)cc2)NC(=O)N(CC(=O)c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C21H20F2N2O3/c1-2-3-11-21(15-7-9-16(22)10-8-15)19(27)25(20(28)24-21)13-18(26)14-5-4-6-17(23)12-14/h4-10,12H,2-3,11,13H2,1H3,(H,24,28)/t21-/m0/s1 |
| InChIKey | CUHIQOCXHDDKOU-NRFANRHFSA-N |
| XLogP | 3.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|