C17H19F4N3O3 — CID 42898744
2-[4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 42898744) has the molecular formula C17H19F4N3O3 and a molecular weight of 389.35 g/mol. Its IUPAC name is 2-[4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 42898744 |
| Molecular Formula | C17H19F4N3O3 |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-[4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCCCC1(c2ccc(F)cc2)NC(=O)N(CC(=O)NCC(F)(F)F)C1=O |
| InChI | InChI=1S/C17H19F4N3O3/c1-2-3-8-16(11-4-6-12(18)7-5-11)14(26)24(15(27)23-16)9-13(25)22-10-17(19,20)21/h4-7H,2-3,8-10H2,1H3,(H,22,25)(H,23,27) |
| InChIKey | JKPGBAQNHOSBEX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|