C21H30FN3O3 — CID 8571329
2-[(4R)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(2R)-6-methylheptan-2-yl]acetamide (PubChem CID 8571329) has the molecular formula C21H30FN3O3 and a molecular weight of 391.49 g/mol. Its IUPAC name is 2-[(4R)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(2R)-6-methylheptan-2-yl]acetamide.
| Compound Name | 2-[(4R)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(2R)-6-methylheptan-2-yl]acetamide |
|---|---|
| PubChem CID | 8571329 |
| Molecular Formula | C21H30FN3O3 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 2-[(4R)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(2R)-6-methylheptan-2-yl]acetamide |
| SMILES | CC[C@]1(c2ccc(F)cc2)NC(=O)N(CC(=O)N[C@H](C)CCCC(C)C)C1=O |
| InChI | InChI=1S/C21H30FN3O3/c1-5-21(16-9-11-17(22)12-10-16)19(27)25(20(28)24-21)13-18(26)23-15(4)8-6-7-14(2)3/h9-12,14-15H,5-8,13H2,1-4H3,(H,23,26)(H,24,28)/t15-,21-/m1/s1 |
| InChIKey | XDNRFOVMKKTSJJ-QVKFZJNVSA-N |
| XLogP | 3.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|