C24H28FN3O3 — CID 8521703
2-[(4S)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(1S)-3-methyl-1-phenylbutyl]acetamide (PubChem CID 8521703) has the molecular formula C24H28FN3O3 and a molecular weight of 425.50 g/mol. Its IUPAC name is 2-[(4S)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(1S)-3-methyl-1-phenylbutyl]acetamide.
| Compound Name | 2-[(4S)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(1S)-3-methyl-1-phenylbutyl]acetamide |
|---|---|
| PubChem CID | 8521703 |
| Molecular Formula | C24H28FN3O3 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 2-[(4S)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(1S)-3-methyl-1-phenylbutyl]acetamide |
| SMILES | CC[C@@]1(c2ccc(F)cc2)NC(=O)N(CC(=O)N[C@@H](CC(C)C)c2ccccc2)C1=O |
| InChI | InChI=1S/C24H28FN3O3/c1-4-24(18-10-12-19(25)13-11-18)22(30)28(23(31)27-24)15-21(29)26-20(14-16(2)3)17-8-6-5-7-9-17/h5-13,16,20H,4,14-15H2,1-3H3,(H,26,29)(H,27,31)/t20-,24-/m0/s1 |
| InChIKey | IKSZGURCZDGRJF-RDPSFJRHSA-N |
| XLogP | 3.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|