C24H29N3O3 — CID 43027676
2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(3-methyl-1-phenylbutyl)acetamide (PubChem CID 43027676) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(3-methyl-1-phenylbutyl)acetamide.
| Compound Name | 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(3-methyl-1-phenylbutyl)acetamide |
|---|---|
| PubChem CID | 43027676 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(3-methyl-1-phenylbutyl)acetamide |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)NC(CC(C)C)c2ccccc2)C1=O |
| InChI | InChI=1S/C24H29N3O3/c1-4-24(19-13-9-6-10-14-19)22(29)27(23(30)26-24)16-21(28)25-20(15-17(2)3)18-11-7-5-8-12-18/h5-14,17,20H,4,15-16H2,1-3H3,(H,25,28)(H,26,30) |
| InChIKey | PREWGGCECQMYHR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|