C18H25N3O3 — CID 8849641
2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[(2R)-pentan-2-yl]acetamide (PubChem CID 8849641) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[(2R)-pentan-2-yl]acetamide.
| Compound Name | 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[(2R)-pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 8849641 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[(2R)-pentan-2-yl]acetamide |
| SMILES | CCC[C@@H](C)NC(=O)CN1C(=O)N[C@](CC)(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H25N3O3/c1-4-9-13(3)19-15(22)12-21-16(23)18(5-2,20-17(21)24)14-10-7-6-8-11-14/h6-8,10-11,13H,4-5,9,12H2,1-3H3,(H,19,22)(H,20,24)/t13-,18-/m1/s1 |
| InChIKey | GSOYLLQZTPLUFX-FZKQIMNGSA-N |
| XLogP | 2.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|