C22H33N3O4 — CID 8566066
2-[(4R)-4-ethyl-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(2R)-octan-2-yl]acetamide (PubChem CID 8566066) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is 2-[(4R)-4-ethyl-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(2R)-octan-2-yl]acetamide.
| Compound Name | 2-[(4R)-4-ethyl-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(2R)-octan-2-yl]acetamide |
|---|---|
| PubChem CID | 8566066 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 2-[(4R)-4-ethyl-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(2R)-octan-2-yl]acetamide |
| SMILES | CCCCCC[C@@H](C)NC(=O)CN1C(=O)N[C@](CC)(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C22H33N3O4/c1-5-7-8-9-10-16(3)23-19(26)15-25-20(27)22(6-2,24-21(25)28)17-11-13-18(29-4)14-12-17/h11-14,16H,5-10,15H2,1-4H3,(H,23,26)(H,24,28)/t16-,22-/m1/s1 |
| InChIKey | QOBZKCHCVNDVLJ-OPAMFIHVSA-N |
| XLogP | 3.33 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|