C17H23N3O4 — CID 7179501
2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[(2R)-1-methoxypropan-2-yl]acetamide (PubChem CID 7179501) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[(2R)-1-methoxypropan-2-yl]acetamide.
| Compound Name | 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[(2R)-1-methoxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 7179501 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[(2R)-1-methoxypropan-2-yl]acetamide |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(CC(=O)N[C@H](C)COC)C1=O |
| InChI | InChI=1S/C17H23N3O4/c1-4-17(13-8-6-5-7-9-13)15(22)20(16(23)19-17)10-14(21)18-12(2)11-24-3/h5-9,12H,4,10-11H2,1-3H3,(H,18,21)(H,19,23)/t12-,17-/m1/s1 |
| InChIKey | DDFXJYVTAUMIRC-SJKOYZFVSA-N |
| XLogP | 0.99 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|