C21H31N3O3 — CID 8572588
2-[(4R)-2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl]-N-[(2R)-5-methylhexan-2-yl]acetamide (PubChem CID 8572588) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-[(4R)-2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl]-N-[(2R)-5-methylhexan-2-yl]acetamide.
| Compound Name | 2-[(4R)-2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl]-N-[(2R)-5-methylhexan-2-yl]acetamide |
|---|---|
| PubChem CID | 8572588 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 2-[(4R)-2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl]-N-[(2R)-5-methylhexan-2-yl]acetamide |
| SMILES | CCC[C@]1(c2ccccc2)NC(=O)N(CC(=O)N[C@H](C)CCC(C)C)C1=O |
| InChI | InChI=1S/C21H31N3O3/c1-5-13-21(17-9-7-6-8-10-17)19(26)24(20(27)23-21)14-18(25)22-16(4)12-11-15(2)3/h6-10,15-16H,5,11-14H2,1-4H3,(H,22,25)(H,23,27)/t16-,21-/m1/s1 |
| InChIKey | ZLDJWVFKCXMLJT-IIBYNOLFSA-N |
| XLogP | 3.17 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|