C26H23ClFN3O3 — CID 40974556
N-[(S)-(4-chlorophenyl)-phenylmethyl]-2-[(4R)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 40974556) has the molecular formula C26H23ClFN3O3 and a molecular weight of 479.94 g/mol. Its IUPAC name is N-[(S)-(4-chlorophenyl)-phenylmethyl]-2-[(4R)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[(S)-(4-chlorophenyl)-phenylmethyl]-2-[(4R)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 40974556 |
| Molecular Formula | C26H23ClFN3O3 |
| Molecular Weight | 479.94 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | N-[(S)-(4-chlorophenyl)-phenylmethyl]-2-[(4R)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC[C@]1(c2ccc(F)cc2)NC(=O)N(CC(=O)N[C@@H](c2ccccc2)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C26H23ClFN3O3/c1-2-26(19-10-14-21(28)15-11-19)24(33)31(25(34)30-26)16-22(32)29-23(17-6-4-3-5-7-17)18-8-12-20(27)13-9-18/h3-15,23H,2,16H2,1H3,(H,29,32)(H,30,34)/t23-,26+/m0/s1 |
| InChIKey | GSTUBCIICFVWAW-JYFHCDHNSA-N |
| XLogP | 4.54 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.94 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|