C18H19N3O4S — CID 52507734
N-(2-methoxy-5-methylphenyl)-2-[(4R)-4-methyl-2,5-dioxo-4-thiophen-3-ylimidazolidin-1-yl]acetamide (PubChem CID 52507734) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is N-(2-methoxy-5-methylphenyl)-2-[(4R)-4-methyl-2,5-dioxo-4-thiophen-3-ylimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-methoxy-5-methylphenyl)-2-[(4R)-4-methyl-2,5-dioxo-4-thiophen-3-ylimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 52507734 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-(2-methoxy-5-methylphenyl)-2-[(4R)-4-methyl-2,5-dioxo-4-thiophen-3-ylimidazolidin-1-yl]acetamide |
| SMILES | COc1ccc(C)cc1NC(=O)CN1C(=O)N[C@](C)(c2ccsc2)C1=O |
| InChI | InChI=1S/C18H19N3O4S/c1-11-4-5-14(25-3)13(8-11)19-15(22)9-21-16(23)18(2,20-17(21)24)12-6-7-26-10-12/h4-8,10H,9H2,1-3H3,(H,19,22)(H,20,24)/t18-/m1/s1 |
| InChIKey | AMERDAGVCOOSMV-GOSISDBHSA-N |
| XLogP | 2.47 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|