C22H20N4O3S — CID 16549239
2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[4-(1,3-thiazol-2-yl)phenyl]acetamide (PubChem CID 16549239) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[4-(1,3-thiazol-2-yl)phenyl]acetamide.
| Compound Name | 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[4-(1,3-thiazol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 16549239 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[4-(1,3-thiazol-2-yl)phenyl]acetamide |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)Nc2ccc(-c3nccs3)cc2)C1=O |
| InChI | InChI=1S/C22H20N4O3S/c1-2-22(16-6-4-3-5-7-16)20(28)26(21(29)25-22)14-18(27)24-17-10-8-15(9-11-17)19-23-12-13-30-19/h3-13H,2,14H2,1H3,(H,24,27)(H,25,29) |
| InChIKey | WQGDNPGQDTZSRT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|