C18H18N4O4S — CID 51563729
2-[[2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]amino]thiophene-3-carboxamide (PubChem CID 51563729) has the molecular formula C18H18N4O4S and a molecular weight of 386.43 g/mol. Its IUPAC name is 2-[[2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 51563729 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-[[2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]amino]thiophene-3-carboxamide |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(CC(=O)Nc2sccc2C(N)=O)C1=O |
| InChI | InChI=1S/C18H18N4O4S/c1-2-18(11-6-4-3-5-7-11)16(25)22(17(26)21-18)10-13(23)20-15-12(14(19)24)8-9-27-15/h3-9H,2,10H2,1H3,(H2,19,24)(H,20,23)(H,21,26)/t18-/m1/s1 |
| InChIKey | MSGBBSBTXHEHQO-GOSISDBHSA-N |
| XLogP | 1.64 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|