C24H22N4O4S — CID 42921307
2-[[2-[4-(3,4-dimethylphenyl)-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]amino]thiophene-3-carboxamide (PubChem CID 42921307) has the molecular formula C24H22N4O4S and a molecular weight of 462.53 g/mol. Its IUPAC name is 2-[[2-[4-(3,4-dimethylphenyl)-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[4-(3,4-dimethylphenyl)-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 42921307 |
| Molecular Formula | C24H22N4O4S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 2-[[2-[4-(3,4-dimethylphenyl)-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]amino]thiophene-3-carboxamide |
| SMILES | Cc1ccc(C2(c3ccccc3)NC(=O)N(CC(=O)Nc3sccc3C(N)=O)C2=O)cc1C |
| InChI | InChI=1S/C24H22N4O4S/c1-14-8-9-17(12-15(14)2)24(16-6-4-3-5-7-16)22(31)28(23(32)27-24)13-19(29)26-21-18(20(25)30)10-11-33-21/h3-12H,13H2,1-2H3,(H2,25,30)(H,26,29)(H,27,32) |
| InChIKey | DPDMNWMZEWHNTE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|