C24H27N3O3 — CID 8673010
(5R)-5-(3,4-dimethylphenyl)-3-(2-oxo-2-piperidin-1-ylethyl)-5-phenylimidazolidine-2,4-dione (PubChem CID 8673010) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is (5R)-5-(3,4-dimethylphenyl)-3-(2-oxo-2-piperidin-1-ylethyl)-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-(3,4-dimethylphenyl)-3-(2-oxo-2-piperidin-1-ylethyl)-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 8673010 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (5R)-5-(3,4-dimethylphenyl)-3-(2-oxo-2-piperidin-1-ylethyl)-5-phenylimidazolidine-2,4-dione |
| SMILES | Cc1ccc([C@@]2(c3ccccc3)NC(=O)N(CC(=O)N3CCCCC3)C2=O)cc1C |
| InChI | InChI=1S/C24H27N3O3/c1-17-11-12-20(15-18(17)2)24(19-9-5-3-6-10-19)22(29)27(23(30)25-24)16-21(28)26-13-7-4-8-14-26/h3,5-6,9-12,15H,4,7-8,13-14,16H2,1-2H3,(H,25,30)/t24-/m1/s1 |
| InChIKey | CSRJGHNUGFWMSC-XMMPIXPASA-N |
| XLogP | 3.11 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|