C28H29N5O3 — CID 51565929
(5S)-5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 51565929) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is (5S)-5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51565929 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | (5S)-5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | Cc1ccc([C@]2(c3ccccc3)NC(=O)N(CC(=O)N3CCN(c4ccccn4)CC3)C2=O)cc1C |
| InChI | InChI=1S/C28H29N5O3/c1-20-11-12-23(18-21(20)2)28(22-8-4-3-5-9-22)26(35)33(27(36)30-28)19-25(34)32-16-14-31(15-17-32)24-10-6-7-13-29-24/h3-13,18H,14-17,19H2,1-2H3,(H,30,36)/t28-/m0/s1 |
| InChIKey | WUAUKPVBPKKJJU-NDEPHWFRSA-N |
| XLogP | 2.84 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|