C23H27N3O2 — CID 9184161
(5S)-5-(3,4-dimethylphenyl)-5-phenyl-3-(piperidin-1-ylmethyl)imidazolidine-2,4-dione (PubChem CID 9184161) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is (5S)-5-(3,4-dimethylphenyl)-5-phenyl-3-(piperidin-1-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(3,4-dimethylphenyl)-5-phenyl-3-(piperidin-1-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9184161 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | (5S)-5-(3,4-dimethylphenyl)-5-phenyl-3-(piperidin-1-ylmethyl)imidazolidine-2,4-dione |
| SMILES | Cc1ccc([C@]2(c3ccccc3)NC(=O)N(CN3CCCCC3)C2=O)cc1C |
| InChI | InChI=1S/C23H27N3O2/c1-17-11-12-20(15-18(17)2)23(19-9-5-3-6-10-19)21(27)26(22(28)24-23)16-25-13-7-4-8-14-25/h3,5-6,9-12,15H,4,7-8,13-14,16H2,1-2H3,(H,24,28)/t23-/m0/s1 |
| InChIKey | HWFDVHUSQNXXJM-QHCPKHFHSA-N |
| XLogP | 3.54 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|