C25H22N2O4 — CID 9291310
(5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-(3,4-dimethylphenyl)-5-phenylimidazolidine-2,4-dione (PubChem CID 9291310) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-(3,4-dimethylphenyl)-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-(3,4-dimethylphenyl)-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9291310 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-(3,4-dimethylphenyl)-5-phenylimidazolidine-2,4-dione |
| SMILES | Cc1ccc([C@]2(c3ccccc3)NC(=O)N(Cc3ccc4c(c3)OCO4)C2=O)cc1C |
| InChI | InChI=1S/C25H22N2O4/c1-16-8-10-20(12-17(16)2)25(19-6-4-3-5-7-19)23(28)27(24(29)26-25)14-18-9-11-21-22(13-18)31-15-30-21/h3-13H,14-15H2,1-2H3,(H,26,29)/t25-/m0/s1 |
| InChIKey | ZNVPBXKSWLKJCS-VWLOTQADSA-N |
| XLogP | 4.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|