C25H21N3O2 — CID 8672971
4-[[(4S)-4-(3,4-dimethylphenyl)-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]benzonitrile (PubChem CID 8672971) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 4-[[(4S)-4-(3,4-dimethylphenyl)-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[(4S)-4-(3,4-dimethylphenyl)-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 8672971 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 4-[[(4S)-4-(3,4-dimethylphenyl)-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]benzonitrile |
| SMILES | Cc1ccc([C@]2(c3ccccc3)NC(=O)N(Cc3ccc(C#N)cc3)C2=O)cc1C |
| InChI | InChI=1S/C25H21N3O2/c1-17-8-13-22(14-18(17)2)25(21-6-4-3-5-7-21)23(29)28(24(30)27-25)16-20-11-9-19(15-26)10-12-20/h3-14H,16H2,1-2H3,(H,27,30)/t25-/m0/s1 |
| InChIKey | WONWUTYUSVNEFP-VWLOTQADSA-N |
| XLogP | 4.17 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|