C24H19N3O2 — CID 3936185
4-[(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)methyl]benzonitrile (PubChem CID 3936185) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 4-[(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)methyl]benzonitrile.
| Compound Name | 4-[(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 3936185 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 4-[(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2C(=O)NC(Cc3ccccc3)(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H19N3O2/c25-16-19-11-13-20(14-12-19)17-27-22(28)24(26-23(27)29,21-9-5-2-6-10-21)15-18-7-3-1-4-8-18/h1-14H,15,17H2,(H,26,29) |
| InChIKey | VCXVYZPXOPGZDM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|