C20H19N7O2 — CID 9451754
(5S)-5-benzyl-3-[(4,6-diamino-1,3,5-triazin-2-yl)methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 9451754) has the molecular formula C20H19N7O2 and a molecular weight of 389.42 g/mol. Its IUPAC name is (5S)-5-benzyl-3-[(4,6-diamino-1,3,5-triazin-2-yl)methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-benzyl-3-[(4,6-diamino-1,3,5-triazin-2-yl)methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9451754 |
| Molecular Formula | C20H19N7O2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (5S)-5-benzyl-3-[(4,6-diamino-1,3,5-triazin-2-yl)methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | Nc1nc(N)nc(CN2C(=O)N[C@@](Cc3ccccc3)(c3ccccc3)C2=O)n1 |
| InChI | InChI=1S/C20H19N7O2/c21-17-23-15(24-18(22)25-17)12-27-16(28)20(26-19(27)29,14-9-5-2-6-10-14)11-13-7-3-1-4-8-13/h1-10H,11-12H2,(H,26,29)(H4,21,22,23,24,25)/t20-/m0/s1 |
| InChIKey | KSNKYRYWNWGINM-FQEVSTJZSA-N |
| XLogP | 1.23 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|