C26H26N2O4 — CID 17410774
5-benzyl-3-[(4,5-dimethoxy-2-methylphenyl)methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 17410774) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 5-benzyl-3-[(4,5-dimethoxy-2-methylphenyl)methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | 5-benzyl-3-[(4,5-dimethoxy-2-methylphenyl)methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17410774 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 5-benzyl-3-[(4,5-dimethoxy-2-methylphenyl)methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | COc1cc(C)c(CN2C(=O)NC(Cc3ccccc3)(c3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C26H26N2O4/c1-18-14-22(31-2)23(32-3)15-20(18)17-28-24(29)26(27-25(28)30,21-12-8-5-9-13-21)16-19-10-6-4-7-11-19/h4-15H,16-17H2,1-3H3,(H,27,30) |
| InChIKey | JNIIMXSGFFGARU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|