C23H15F5N2O2 — CID 41305462
(5S)-5-benzyl-3-[(2,3,4,5,6-pentafluorophenyl)methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 41305462) has the molecular formula C23H15F5N2O2 and a molecular weight of 446.38 g/mol. Its IUPAC name is (5S)-5-benzyl-3-[(2,3,4,5,6-pentafluorophenyl)methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-benzyl-3-[(2,3,4,5,6-pentafluorophenyl)methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41305462 |
| Molecular Formula | C23H15F5N2O2 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (5S)-5-benzyl-3-[(2,3,4,5,6-pentafluorophenyl)methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | O=C1N[C@@](Cc2ccccc2)(c2ccccc2)C(=O)N1Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H15F5N2O2/c24-16-15(17(25)19(27)20(28)18(16)26)12-30-21(31)23(29-22(30)32,14-9-5-2-6-10-14)11-13-7-3-1-4-8-13/h1-10H,11-12H2,(H,29,32)/t23-/m0/s1 |
| InChIKey | RPXUOYOWMPMAMT-QHCPKHFHSA-N |
| XLogP | 4.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|