C24H21FN2O3 — CID 7240283
(5R)-5-benzyl-3-[2-(4-fluorophenoxy)ethyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 7240283) has the molecular formula C24H21FN2O3 and a molecular weight of 404.44 g/mol. Its IUPAC name is (5R)-5-benzyl-3-[2-(4-fluorophenoxy)ethyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-benzyl-3-[2-(4-fluorophenoxy)ethyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7240283 |
| Molecular Formula | C24H21FN2O3 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (5R)-5-benzyl-3-[2-(4-fluorophenoxy)ethyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | O=C1N[C@](Cc2ccccc2)(c2ccccc2)C(=O)N1CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C24H21FN2O3/c25-20-11-13-21(14-12-20)30-16-15-27-22(28)24(26-23(27)29,19-9-5-2-6-10-19)17-18-7-3-1-4-8-18/h1-14H,15-17H2,(H,26,29)/t24-/m1/s1 |
| InChIKey | OREBWSNWGPXZBF-XMMPIXPASA-N |
| XLogP | 3.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|