C21H24FN3O5S — CID 30804847
4-[2-[(4R)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]ethoxy]-N,N-dimethylbenzenesulfonamide (PubChem CID 30804847) has the molecular formula C21H24FN3O5S and a molecular weight of 449.50 g/mol. Its IUPAC name is 4-[2-[(4R)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]ethoxy]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[2-[(4R)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]ethoxy]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 30804847 |
| Molecular Formula | C21H24FN3O5S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 4-[2-[(4R)-4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]ethoxy]-N,N-dimethylbenzenesulfonamide |
| SMILES | CC[C@]1(c2ccc(F)cc2)NC(=O)N(CCOc2ccc(S(=O)(=O)N(C)C)cc2)C1=O |
| InChI | InChI=1S/C21H24FN3O5S/c1-4-21(15-5-7-16(22)8-6-15)19(26)25(20(27)23-21)13-14-30-17-9-11-18(12-10-17)31(28,29)24(2)3/h5-12H,4,13-14H2,1-3H3,(H,23,27)/t21-/m1/s1 |
| InChIKey | XMCPKXQAUASKRP-OAQYLSRUSA-N |
| XLogP | 2.31 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|